C39H59N3O9 — CID 162036532
benzyl N-[(1S,3R)-3-aminocyclohexyl]carbamate;benzyl N-[(1S,3R)-3-methylcyclohexyl]carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate (PubChem CID 162036532) has the molecular formula C39H59N3O9 and a molecular weight of 713.91 g/mol. Its IUPAC name is benzyl N-[(1S,3R)-3-aminocyclohexyl]carbamate;benzyl N-[(1S,3R)-3-methylcyclohexyl]carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate.
| Compound Name | benzyl N-[(1S,3R)-3-aminocyclohexyl]carbamate;benzyl N-[(1S,3R)-3-methylcyclohexyl]carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
|---|---|
| PubChem CID | 162036532 |
| Molecular Formula | C39H59N3O9 |
| Molecular Weight | 713.91 g/mol |
| Exact Mass | 713.43 |
| IUPAC Name | benzyl N-[(1S,3R)-3-aminocyclohexyl]carbamate;benzyl N-[(1S,3R)-3-methylcyclohexyl]carbamate;tert-butyl (2-methylpropan-2-yl)oxycarbonyl carbonate |
| SMILES | CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.C[C@@H]1CCC[C@H](NC(=O)OCc2ccccc2)C1.N[C@@H]1CCC[C@H](NC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C15H21NO2.C14H20N2O2.C10H18O5/c1-12-6-5-9-14(10-12)16-15(17)18-11-13-7-3-2-4-8-13;15-12-7-4-8-13(9-12)16-14(17)18-10-11-5-2-1-3-6-11;1-9(2,3)14-7(11)13-8(12)15-10(4,5)6/h2-4,7-8,12,14H,5-6,9-11H2,1H3,(H,16,17);1-3,5-6,12-13H,4,7-10,15H2,(H,16,17);1-6H3/t12-,14+;12-,13+;/m11./s1 |
| InChIKey | YWSLEZFYSAOXOH-OJKBHAAGSA-N |
| XLogP | 8.55 |
| TPSA | 164.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.91 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|