C20H30AsNO4 — CID 173258206
benzyl [3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methylarsanylformate (PubChem CID 173258206) has the molecular formula C20H30AsNO4 and a molecular weight of 423.39 g/mol. Its IUPAC name is benzyl [3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methylarsanylformate.
| Compound Name | benzyl [3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methylarsanylformate |
|---|---|
| PubChem CID | 173258206 |
| Molecular Formula | C20H30AsNO4 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | benzyl [3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]methylarsanylformate |
| SMILES | CC(C)(C)OC(=O)NC1CCCC(C[AsH]C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C20H30AsNO4/c1-20(2,3)26-19(24)22-17-11-7-10-16(12-17)13-21-18(23)25-14-15-8-5-4-6-9-15/h4-6,8-9,16-17,21H,7,10-14H2,1-3H3,(H,22,24) |
| InChIKey | CMILBWUSUWZKFF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|