C19H21N4+ — CID 162037826
3-isoquinolin-1-yl-7,10,10-trimethyl-4,5-diaza-2-azoniatricyclo[5.2.1.02,6]deca-2(6),3-diene (PubChem CID 162037826) has the molecular formula C19H21N4+ and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-isoquinolin-1-yl-7,10,10-trimethyl-4,5-diaza-2-azoniatricyclo[5.2.1.02,6]deca-2(6),3-diene.
| Compound Name | 3-isoquinolin-1-yl-7,10,10-trimethyl-4,5-diaza-2-azoniatricyclo[5.2.1.02,6]deca-2(6),3-diene |
|---|---|
| PubChem CID | 162037826 |
| Molecular Formula | C19H21N4+ |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 3-isoquinolin-1-yl-7,10,10-trimethyl-4,5-diaza-2-azoniatricyclo[5.2.1.02,6]deca-2(6),3-diene |
| SMILES | CC12CCC([n+]3c(-c4nccc5ccccc45)n[nH]c31)C2(C)C |
| InChI | InChI=1S/C19H20N4/c1-18(2)14-8-10-19(18,3)17-22-21-16(23(14)17)15-13-7-5-4-6-12(13)9-11-20-15/h4-7,9,11,14H,8,10H2,1-3H3/p+1 |
| InChIKey | MMINXDWFJXTVLI-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|