C15H10N4S — CID 62733394
1-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)isoquinoline (PubChem CID 62733394) has the molecular formula C15H10N4S and a molecular weight of 278.34 g/mol. Its IUPAC name is 1-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)isoquinoline.
| Compound Name | 1-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)isoquinoline |
|---|---|
| PubChem CID | 62733394 |
| Molecular Formula | C15H10N4S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-(5-thiophen-2-yl-1H-1,2,4-triazol-3-yl)isoquinoline |
| SMILES | c1csc(-c2nc(-c3nccc4ccccc34)n[nH]2)c1 |
| InChI | InChI=1S/C15H10N4S/c1-2-5-11-10(4-1)7-8-16-13(11)15-17-14(18-19-15)12-6-3-9-20-12/h1-9H,(H,17,18,19) |
| InChIKey | GSBXDORNTCJRLC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |