C26H26N2O4 — CID 162046390
4-(2-pyridin-3-ylethyl)benzene-1,3-diol (PubChem CID 162046390) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 4-(2-pyridin-3-ylethyl)benzene-1,3-diol.
| Compound Name | 4-(2-pyridin-3-ylethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 162046390 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 4-(2-pyridin-3-ylethyl)benzene-1,3-diol |
| SMILES | Oc1ccc(CCc2cccnc2)c(O)c1.Oc1ccc(CCc2cccnc2)c(O)c1 |
| InChI | InChI=1S/2C13H13NO2/c2*15-12-6-5-11(13(16)8-12)4-3-10-2-1-7-14-9-10/h2*1-2,5-9,15-16H,3-4H2 |
| InChIKey | YXYDVCKIUZGLDK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |