About 1-bromo-2-methylbenzene;deuterium monohydride;1-methyl-2-(2-methylphenyl)benzene
1-bromo-2-methylbenzene;deuterium monohydride;1-methyl-2-(2-methylphenyl)benzene (PubChem CID 162050163) has the molecular formula C21H23Br
and a molecular weight of 356.33 g/mol. Its IUPAC name is 1-bromo-2-methylbenzene;deuterium monohydride;1-methyl-2-(2-methylphenyl)benzene.
Molecular Properties
| Compound Name | 1-bromo-2-methylbenzene;deuterium monohydride;1-methyl-2-(2-methylphenyl)benzene |
| PubChem CID | 162050163 |
| Molecular Formula | C21H23Br |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 1-bromo-2-methylbenzene;deuterium monohydride;1-methyl-2-(2-methylphenyl)benzene |
| SMILES | Cc1ccccc1-c1ccccc1C.Cc1ccccc1Br.[H][2H] |
| InChI | InChI=1S/C14H14.C7H7Br.H2/c1-11-7-3-5-9-13(11)14-10-6-4-8-12(14)2;1-6-4-2-3-5-7(6)8;/h3-10H,1-2H3;2-5H,1H3;1H/i;;1+1 |
| InChIKey | YYLCELABKOJJTL-FCHARDOESA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-2-methylbenzene;deuterium monohydride;1-methyl-2-(2-methylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-methylbenzene;deuterium monohydride;1-methyl-2-(2-methylphenyl)benzene?
The IUPAC name of 1-bromo-2-methylbenzene;deuterium monohydride;1-methyl-2-(2-methylphenyl)benzene (CID 162050163) is 1-bromo-2-methylbenzene;deuterium monohydride;1-methyl-2-(2-methylphenyl)benzene.
What is the SMILES notation for 1-bromo-2-methylbenzene;deuterium monohydride;1-methyl-2-(2-methylphenyl)benzene?
The canonical SMILES for 1-bromo-2-methylbenzene;deuterium monohydride;1-methyl-2-(2-methylphenyl)benzene is Cc1ccccc1-c1ccccc1C.Cc1ccccc1Br.[H][2H].
What is the InChIKey of 1-bromo-2-methylbenzene;deuterium monohydride;1-methyl-2-(2-methylphenyl)benzene?
The InChIKey is YYLCELABKOJJTL-FCHARDOESA-N. The full InChI is InChI=1S/C14H14.C7H7Br.H2/c1-11-7-3-5-9-13(11)14-10-6-4-8-12(14)2;1-6-4-2-3-5-7(6)8;/h3-10H,1-2H3;2-5H,1H3;1H/i;;1+1.
What are the key properties of 1-bromo-2-methylbenzene;deuterium monohydride;1-methyl-2-(2-methylphenyl)benzene?
1-bromo-2-methylbenzene;deuterium monohydride;1-methyl-2-(2-methylphenyl)benzene has a molecular weight of 356.33 g/mol, XLogP of 6.97, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-methylbenzene;deuterium monohydride;1-methyl-2-(2-methylphenyl)benzene is sourced from PubChem (CID 162050163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).