About 1-bromo-2-methylbenzene;N-phosphanylmethanamine
1-bromo-2-methylbenzene;N-phosphanylmethanamine (PubChem CID 91254486) has the molecular formula C8H13BrNP
and a molecular weight of 234.08 g/mol. Its IUPAC name is 1-bromo-2-methylbenzene;N-phosphanylmethanamine.
Molecular Properties
| Compound Name | 1-bromo-2-methylbenzene;N-phosphanylmethanamine |
| PubChem CID | 91254486 |
| Molecular Formula | C8H13BrNP |
| Molecular Weight | 234.08 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 1-bromo-2-methylbenzene;N-phosphanylmethanamine |
| SMILES | CNP.Cc1ccccc1Br |
| InChI | InChI=1S/C7H7Br.CH6NP/c1-6-4-2-3-5-7(6)8;1-2-3/h2-5H,1H3;2H,3H2,1H3 |
| InChIKey | HPHPEPFFDJYUGW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.08 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-methylbenzene;N-phosphanylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-methylbenzene;N-phosphanylmethanamine?
The IUPAC name of 1-bromo-2-methylbenzene;N-phosphanylmethanamine (CID 91254486) is 1-bromo-2-methylbenzene;N-phosphanylmethanamine.
What is the SMILES notation for 1-bromo-2-methylbenzene;N-phosphanylmethanamine?
The canonical SMILES for 1-bromo-2-methylbenzene;N-phosphanylmethanamine is CNP.Cc1ccccc1Br.
What is the InChIKey of 1-bromo-2-methylbenzene;N-phosphanylmethanamine?
The InChIKey is HPHPEPFFDJYUGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Br.CH6NP/c1-6-4-2-3-5-7(6)8;1-2-3/h2-5H,1H3;2H,3H2,1H3.
What are the key properties of 1-bromo-2-methylbenzene;N-phosphanylmethanamine?
1-bromo-2-methylbenzene;N-phosphanylmethanamine has a molecular weight of 234.08 g/mol, XLogP of 2.75, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-methylbenzene;N-phosphanylmethanamine is sourced from PubChem (CID 91254486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).