C13H24ClN2O4P2+ — CID 162053853
[3-amino-3-(4-chlorophenyl)propyl]-hydroxy-oxophosphanium;3-aminopropyl(methyl)phosphinic acid (PubChem CID 162053853) has the molecular formula C13H24ClN2O4P2+ and a molecular weight of 369.75 g/mol. Its IUPAC name is [3-amino-3-(4-chlorophenyl)propyl]-hydroxy-oxophosphanium;3-aminopropyl(methyl)phosphinic acid.
| Compound Name | [3-amino-3-(4-chlorophenyl)propyl]-hydroxy-oxophosphanium;3-aminopropyl(methyl)phosphinic acid |
|---|---|
| PubChem CID | 162053853 |
| Molecular Formula | C13H24ClN2O4P2+ |
| Molecular Weight | 369.75 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | [3-amino-3-(4-chlorophenyl)propyl]-hydroxy-oxophosphanium;3-aminopropyl(methyl)phosphinic acid |
| SMILES | CP(=O)(O)CCCN.NC(CC[P+](=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H11ClNO2P.C4H12NO2P/c10-8-3-1-7(2-4-8)9(11)5-6-14(12)13;1-8(6,7)4-2-3-5/h1-4,9H,5-6,11H2;2-5H2,1H3,(H,6,7)/p+1 |
| InChIKey | RVPDZPMEYHERQF-UHFFFAOYSA-O |
| XLogP | 2.70 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|