About oxadiazole;pyrrolidine-3-carboxylic acid
oxadiazole;pyrrolidine-3-carboxylic acid (PubChem CID 162054927) has the molecular formula C7H11N3O3
and a molecular weight of 185.18 g/mol. Its IUPAC name is oxadiazole;pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | oxadiazole;pyrrolidine-3-carboxylic acid |
| PubChem CID | 162054927 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | oxadiazole;pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCNC1.c1conn1 |
| InChI | InChI=1S/C5H9NO2.C2H2N2O/c7-5(8)4-1-2-6-3-4;1-2-5-4-3-1/h4,6H,1-3H2,(H,7,8);1-2H |
| InChIKey | YZAXHUVVCRUBDY-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze oxadiazole;pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxadiazole;pyrrolidine-3-carboxylic acid?
The IUPAC name of oxadiazole;pyrrolidine-3-carboxylic acid (CID 162054927) is oxadiazole;pyrrolidine-3-carboxylic acid.
What is the SMILES notation for oxadiazole;pyrrolidine-3-carboxylic acid?
The canonical SMILES for oxadiazole;pyrrolidine-3-carboxylic acid is O=C(O)C1CCNC1.c1conn1.
What is the InChIKey of oxadiazole;pyrrolidine-3-carboxylic acid?
The InChIKey is YZAXHUVVCRUBDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.C2H2N2O/c7-5(8)4-1-2-6-3-4;1-2-5-4-3-1/h4,6H,1-3H2,(H,7,8);1-2H.
What are the key properties of oxadiazole;pyrrolidine-3-carboxylic acid?
oxadiazole;pyrrolidine-3-carboxylic acid has a molecular weight of 185.18 g/mol, XLogP of -0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxadiazole;pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 162054927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).