About oxadiazole;piperidine-3-carboxylic acid
oxadiazole;piperidine-3-carboxylic acid (PubChem CID 157377265) has the molecular formula C8H13N3O3
and a molecular weight of 199.21 g/mol. Its IUPAC name is oxadiazole;piperidine-3-carboxylic acid.
Molecular Properties
| Compound Name | oxadiazole;piperidine-3-carboxylic acid |
| PubChem CID | 157377265 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | oxadiazole;piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCNC1.c1conn1 |
| InChI | InChI=1S/C6H11NO2.C2H2N2O/c8-6(9)5-2-1-3-7-4-5;1-2-5-4-3-1/h5,7H,1-4H2,(H,8,9);1-2H |
| InChIKey | BKLQUBMXBRGRJN-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze oxadiazole;piperidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxadiazole;piperidine-3-carboxylic acid?
The IUPAC name of oxadiazole;piperidine-3-carboxylic acid (CID 157377265) is oxadiazole;piperidine-3-carboxylic acid.
What is the SMILES notation for oxadiazole;piperidine-3-carboxylic acid?
The canonical SMILES for oxadiazole;piperidine-3-carboxylic acid is O=C(O)C1CCCNC1.c1conn1.
What is the InChIKey of oxadiazole;piperidine-3-carboxylic acid?
The InChIKey is BKLQUBMXBRGRJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.C2H2N2O/c8-6(9)5-2-1-3-7-4-5;1-2-5-4-3-1/h5,7H,1-4H2,(H,8,9);1-2H.
What are the key properties of oxadiazole;piperidine-3-carboxylic acid?
oxadiazole;piperidine-3-carboxylic acid has a molecular weight of 199.21 g/mol, XLogP of 0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxadiazole;piperidine-3-carboxylic acid is sourced from PubChem (CID 157377265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).