C29H37Br2ClN2O8 — CID 162056069
2-O-tert-butyl 3-O-methyl 5-bromo-8-methoxy-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate;methyl 5-bromo-8-methoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylate;hydrochloride (PubChem CID 162056069) has the molecular formula C29H37Br2ClN2O8 and a molecular weight of 736.88 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-methyl 5-bromo-8-methoxy-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate;methyl 5-bromo-8-methoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylate;hydrochloride.
| Compound Name | 2-O-tert-butyl 3-O-methyl 5-bromo-8-methoxy-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate;methyl 5-bromo-8-methoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 162056069 |
| Molecular Formula | C29H37Br2ClN2O8 |
| Molecular Weight | 736.88 g/mol |
| Exact Mass | 734.06 |
| IUPAC Name | 2-O-tert-butyl 3-O-methyl 5-bromo-8-methoxy-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate;methyl 5-bromo-8-methoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylate;hydrochloride |
| SMILES | COC(=O)C1Cc2c(Br)ccc(OC)c2CN1.COC(=O)C1Cc2c(Br)ccc(OC)c2CN1C(=O)OC(C)(C)C.Cl |
| InChI | InChI=1S/C17H22BrNO5.C12H14BrNO3.ClH/c1-17(2,3)24-16(21)19-9-11-10(8-13(19)15(20)23-5)12(18)6-7-14(11)22-4;1-16-11-4-3-9(13)7-5-10(12(15)17-2)14-6-8(7)11;/h6-7,13H,8-9H2,1-5H3;3-4,10,14H,5-6H2,1-2H3;1H |
| InChIKey | GQZJFQHOEZOMRJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.88 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|