About N'-[2-(2-hydroxyethylamino)ethyl]-N-propylhexanediamide;methane
N'-[2-(2-hydroxyethylamino)ethyl]-N-propylhexanediamide;methane (PubChem CID 162065601) has the molecular formula C18H47N3O3
and a molecular weight of 353.59 g/mol. Its IUPAC name is N'-[2-(2-hydroxyethylamino)ethyl]-N-propylhexanediamide;methane.
Molecular Properties
| Compound Name | N'-[2-(2-hydroxyethylamino)ethyl]-N-propylhexanediamide;methane |
| PubChem CID | 162065601 |
| Molecular Formula | C18H47N3O3 |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.36 |
| IUPAC Name | N'-[2-(2-hydroxyethylamino)ethyl]-N-propylhexanediamide;methane |
| SMILES | C.C.C.C.C.CCCNC(=O)CCCCC(=O)NCCNCCO |
| InChI | InChI=1S/C13H27N3O3.5CH4/c1-2-7-15-12(18)5-3-4-6-13(19)16-9-8-14-10-11-17;;;;;/h14,17H,2-11H2,1H3,(H,15,18)(H,16,19);5*1H4 |
| InChIKey | ZAKJSAOFRYMLCU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(2-hydroxyethylamino)ethyl]-N-propylhexanediamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(2-hydroxyethylamino)ethyl]-N-propylhexanediamide;methane?
The IUPAC name of N'-[2-(2-hydroxyethylamino)ethyl]-N-propylhexanediamide;methane (CID 162065601) is N'-[2-(2-hydroxyethylamino)ethyl]-N-propylhexanediamide;methane.
What is the SMILES notation for N'-[2-(2-hydroxyethylamino)ethyl]-N-propylhexanediamide;methane?
The canonical SMILES for N'-[2-(2-hydroxyethylamino)ethyl]-N-propylhexanediamide;methane is C.C.C.C.C.CCCNC(=O)CCCCC(=O)NCCNCCO.
What is the InChIKey of N'-[2-(2-hydroxyethylamino)ethyl]-N-propylhexanediamide;methane?
The InChIKey is ZAKJSAOFRYMLCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O3.5CH4/c1-2-7-15-12(18)5-3-4-6-13(19)16-9-8-14-10-11-17;;;;;/h14,17H,2-11H2,1H3,(H,15,18)(H,16,19);5*1H4.
What are the key properties of N'-[2-(2-hydroxyethylamino)ethyl]-N-propylhexanediamide;methane?
N'-[2-(2-hydroxyethylamino)ethyl]-N-propylhexanediamide;methane has a molecular weight of 353.59 g/mol, XLogP of 2.95, 12 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(2-hydroxyethylamino)ethyl]-N-propylhexanediamide;methane is sourced from PubChem (CID 162065601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).