C27H26FN5O2S — CID 162072342
2-[4-anilino-3-(cyclopropylcarbamoyl)-7-fluoroquinolin-6-yl]-N-butyl-1,3-thiazole-4-carboxamide (PubChem CID 162072342) has the molecular formula C27H26FN5O2S and a molecular weight of 503.60 g/mol. Its IUPAC name is 2-[4-anilino-3-(cyclopropylcarbamoyl)-7-fluoroquinolin-6-yl]-N-butyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-anilino-3-(cyclopropylcarbamoyl)-7-fluoroquinolin-6-yl]-N-butyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 162072342 |
| Molecular Formula | C27H26FN5O2S |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 2-[4-anilino-3-(cyclopropylcarbamoyl)-7-fluoroquinolin-6-yl]-N-butyl-1,3-thiazole-4-carboxamide |
| SMILES | CCCCNC(=O)c1csc(-c2cc3c(Nc4ccccc4)c(C(=O)NC4CC4)cnc3cc2F)n1 |
| InChI | InChI=1S/C27H26FN5O2S/c1-2-3-11-29-26(35)23-15-36-27(33-23)18-12-19-22(13-21(18)28)30-14-20(25(34)32-17-9-10-17)24(19)31-16-7-5-4-6-8-16/h4-8,12-15,17H,2-3,9-11H2,1H3,(H,29,35)(H,30,31)(H,32,34) |
| InChIKey | YIDGLAWTDJUDCL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|