About butanedioic acid;2-fluorobenzonitrile
butanedioic acid;2-fluorobenzonitrile (PubChem CID 162076408) has the molecular formula C11H10FNO4
and a molecular weight of 239.20 g/mol. Its IUPAC name is butanedioic acid;2-fluorobenzonitrile.
Molecular Properties
| Compound Name | butanedioic acid;2-fluorobenzonitrile |
| PubChem CID | 162076408 |
| Molecular Formula | C11H10FNO4 |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | butanedioic acid;2-fluorobenzonitrile |
| SMILES | N#Cc1ccccc1F.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C7H4FN.C4H6O4/c8-7-4-2-1-3-6(7)5-9;5-3(6)1-2-4(7)8/h1-4H;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | ZBTKUGOYNMHIJJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butanedioic acid;2-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;2-fluorobenzonitrile?
The IUPAC name of butanedioic acid;2-fluorobenzonitrile (CID 162076408) is butanedioic acid;2-fluorobenzonitrile.
What is the SMILES notation for butanedioic acid;2-fluorobenzonitrile?
The canonical SMILES for butanedioic acid;2-fluorobenzonitrile is N#Cc1ccccc1F.O=C(O)CCC(=O)O.
What is the InChIKey of butanedioic acid;2-fluorobenzonitrile?
The InChIKey is ZBTKUGOYNMHIJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FN.C4H6O4/c8-7-4-2-1-3-6(7)5-9;5-3(6)1-2-4(7)8/h1-4H;1-2H2,(H,5,6)(H,7,8).
What are the key properties of butanedioic acid;2-fluorobenzonitrile?
butanedioic acid;2-fluorobenzonitrile has a molecular weight of 239.20 g/mol, XLogP of 1.63, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;2-fluorobenzonitrile is sourced from PubChem (CID 162076408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).