About 3-propan-2-yloxetane;1-propan-2-ylsulfonylpyrrolidine
3-propan-2-yloxetane;1-propan-2-ylsulfonylpyrrolidine (PubChem CID 162081963) has the molecular formula C13H27NO3S
and a molecular weight of 277.43 g/mol. Its IUPAC name is 3-propan-2-yloxetane;1-propan-2-ylsulfonylpyrrolidine.
Molecular Properties
| Compound Name | 3-propan-2-yloxetane;1-propan-2-ylsulfonylpyrrolidine |
| PubChem CID | 162081963 |
| Molecular Formula | C13H27NO3S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 3-propan-2-yloxetane;1-propan-2-ylsulfonylpyrrolidine |
| SMILES | CC(C)C1COC1.CC(C)S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C7H15NO2S.C6H12O/c1-7(2)11(9,10)8-5-3-4-6-8;1-5(2)6-3-7-4-6/h7H,3-6H2,1-2H3;5-6H,3-4H2,1-2H3 |
| InChIKey | ZCLPFOFVJJANEV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-propan-2-yloxetane;1-propan-2-ylsulfonylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yloxetane;1-propan-2-ylsulfonylpyrrolidine?
The IUPAC name of 3-propan-2-yloxetane;1-propan-2-ylsulfonylpyrrolidine (CID 162081963) is 3-propan-2-yloxetane;1-propan-2-ylsulfonylpyrrolidine.
What is the SMILES notation for 3-propan-2-yloxetane;1-propan-2-ylsulfonylpyrrolidine?
The canonical SMILES for 3-propan-2-yloxetane;1-propan-2-ylsulfonylpyrrolidine is CC(C)C1COC1.CC(C)S(=O)(=O)N1CCCC1.
What is the InChIKey of 3-propan-2-yloxetane;1-propan-2-ylsulfonylpyrrolidine?
The InChIKey is ZCLPFOFVJJANEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2S.C6H12O/c1-7(2)11(9,10)8-5-3-4-6-8;1-5(2)6-3-7-4-6/h7H,3-6H2,1-2H3;5-6H,3-4H2,1-2H3.
What are the key properties of 3-propan-2-yloxetane;1-propan-2-ylsulfonylpyrrolidine?
3-propan-2-yloxetane;1-propan-2-ylsulfonylpyrrolidine has a molecular weight of 277.43 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yloxetane;1-propan-2-ylsulfonylpyrrolidine is sourced from PubChem (CID 162081963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).