C36H37ClN8 — CID 162086523
3-chloro-N-phenylpyrazin-2-amine;3,5-dimethylaniline;3-N-(3,5-dimethylphenyl)-2-N-phenylpyrazine-2,3-diamine (PubChem CID 162086523) has the molecular formula C36H37ClN8 and a molecular weight of 617.20 g/mol. Its IUPAC name is 3-chloro-N-phenylpyrazin-2-amine;3,5-dimethylaniline;3-N-(3,5-dimethylphenyl)-2-N-phenylpyrazine-2,3-diamine.
| Compound Name | 3-chloro-N-phenylpyrazin-2-amine;3,5-dimethylaniline;3-N-(3,5-dimethylphenyl)-2-N-phenylpyrazine-2,3-diamine |
|---|---|
| PubChem CID | 162086523 |
| Molecular Formula | C36H37ClN8 |
| Molecular Weight | 617.20 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | 3-chloro-N-phenylpyrazin-2-amine;3,5-dimethylaniline;3-N-(3,5-dimethylphenyl)-2-N-phenylpyrazine-2,3-diamine |
| SMILES | Cc1cc(C)cc(N)c1.Cc1cc(C)cc(Nc2nccnc2Nc2ccccc2)c1.Clc1nccnc1Nc1ccccc1 |
| InChI | InChI=1S/C18H18N4.C10H8ClN3.C8H11N/c1-13-10-14(2)12-16(11-13)22-18-17(19-8-9-20-18)21-15-6-4-3-5-7-15;11-9-10(13-7-6-12-9)14-8-4-2-1-3-5-8;1-6-3-7(2)5-8(9)4-6/h3-12H,1-2H3,(H,19,21)(H,20,22);1-7H,(H,13,14);3-5H,9H2,1-2H3 |
| InChIKey | ZDAOGIRPYXTPEH-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.20 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|