C32H33F5N6O2S — CID 162089573
1-[1,2-difluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[3-(3-methyl-2-propan-2-ylcyclohexa-1,5-dien-1-yl)-1,3-thiazinan-2-ylidene]urea (PubChem CID 162089573) has the molecular formula C32H33F5N6O2S and a molecular weight of 660.71 g/mol. Its IUPAC name is 1-[1,2-difluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[3-(3-methyl-2-propan-2-ylcyclohexa-1,5-dien-1-yl)-1,3-thiazinan-2-ylidene]urea.
| Compound Name | 1-[1,2-difluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[3-(3-methyl-2-propan-2-ylcyclohexa-1,5-dien-1-yl)-1,3-thiazinan-2-ylidene]urea |
|---|---|
| PubChem CID | 162089573 |
| Molecular Formula | C32H33F5N6O2S |
| Molecular Weight | 660.71 g/mol |
| Exact Mass | 660.23 |
| IUPAC Name | 1-[1,2-difluoro-2-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]ethyl]-3-[3-(3-methyl-2-propan-2-ylcyclohexa-1,5-dien-1-yl)-1,3-thiazinan-2-ylidene]urea |
| SMILES | CC(C)C1=C(N2CCCSC2=NC(=O)NC(F)C(F)c2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)C=CCC1C |
| InChI | InChI=1S/C32H33F5N6O2S/c1-19(2)26-20(3)6-4-7-25(26)42-16-5-17-46-31(42)40-30(44)39-28(34)27(33)21-8-10-22(11-9-21)29-38-18-43(41-29)23-12-14-24(15-13-23)45-32(35,36)37/h4,7-15,18-20,27-28H,5-6,16-17H2,1-3H3,(H,39,44) |
| InChIKey | ZDKOSBDMHSMWSX-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.71 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|