C28H28Cl2F6N8O2S2 — CID 162092499
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)prop-2-enamide;N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-(3,3,3-trifluoropropylsulfanyl)propanamide;3,3,3-trifluoropropane-1-thiol (PubChem CID 162092499) has the molecular formula C28H28Cl2F6N8O2S2 and a molecular weight of 757.61 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)prop-2-enamide;N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-(3,3,3-trifluoropropylsulfanyl)propanamide;3,3,3-trifluoropropane-1-thiol.
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)prop-2-enamide;N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-(3,3,3-trifluoropropylsulfanyl)propanamide;3,3,3-trifluoropropane-1-thiol |
|---|---|
| PubChem CID | 162092499 |
| Molecular Formula | C28H28Cl2F6N8O2S2 |
| Molecular Weight | 757.61 g/mol |
| Exact Mass | 756.11 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)prop-2-enamide;N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-3-(3,3,3-trifluoropropylsulfanyl)propanamide;3,3,3-trifluoropropane-1-thiol |
| SMILES | C=CC(=O)Nc1cn(-c2cccnc2)nc1Cl.FC(F)(F)CCS.O=C(CCSCCC(F)(F)F)Nc1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C14H14ClF3N4OS.C11H9ClN4O.C3H5F3S/c15-13-11(9-22(21-13)10-2-1-5-19-8-10)20-12(23)3-6-24-7-4-14(16,17)18;1-2-10(17)14-9-7-16(15-11(9)12)8-4-3-5-13-6-8;4-3(5,6)1-2-7/h1-2,5,8-9H,3-4,6-7H2,(H,20,23);2-7H,1H2,(H,14,17);7H,1-2H2 |
| InChIKey | ZDUOBCKUMYSJEN-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.61 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|