C26H29ClN4O — CID 162096371
N-[6-(azepan-1-yl)-3-pyridinyl]-4-chloro-2-(dimethylamino)-5-phenylbenzamide (PubChem CID 162096371) has the molecular formula C26H29ClN4O and a molecular weight of 449.00 g/mol. Its IUPAC name is N-[6-(azepan-1-yl)-3-pyridinyl]-4-chloro-2-(dimethylamino)-5-phenylbenzamide.
| Compound Name | N-[6-(azepan-1-yl)-3-pyridinyl]-4-chloro-2-(dimethylamino)-5-phenylbenzamide |
|---|---|
| PubChem CID | 162096371 |
| Molecular Formula | C26H29ClN4O |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | N-[6-(azepan-1-yl)-3-pyridinyl]-4-chloro-2-(dimethylamino)-5-phenylbenzamide |
| SMILES | CN(C)c1cc(Cl)c(-c2ccccc2)cc1C(=O)Nc1ccc(N2CCCCCC2)nc1 |
| InChI | InChI=1S/C26H29ClN4O/c1-30(2)24-17-23(27)21(19-10-6-5-7-11-19)16-22(24)26(32)29-20-12-13-25(28-18-20)31-14-8-3-4-9-15-31/h5-7,10-13,16-18H,3-4,8-9,14-15H2,1-2H3,(H,29,32) |
| InChIKey | ZEHNAQPGGMOGOJ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |