C21H25ClN4O2 — CID 46533335
2-chloro-N-[3-methyl-1-oxo-1-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]butan-2-yl]benzamide (PubChem CID 46533335) has the molecular formula C21H25ClN4O2 and a molecular weight of 400.91 g/mol. Its IUPAC name is 2-chloro-N-[3-methyl-1-oxo-1-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]butan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[3-methyl-1-oxo-1-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 46533335 |
| Molecular Formula | C21H25ClN4O2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-chloro-N-[3-methyl-1-oxo-1-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]butan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccccc1Cl)C(=O)Nc1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C21H25ClN4O2/c1-14(2)19(25-20(27)16-7-3-4-8-17(16)22)21(28)24-15-9-10-18(23-13-15)26-11-5-6-12-26/h3-4,7-10,13-14,19H,5-6,11-12H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | YVGUYLAMYGMTEP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |