C22H28N4O2 — CID 43041619
2-methyl-N-[3-methyl-1-oxo-1-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]butan-2-yl]benzamide (PubChem CID 43041619) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-methyl-N-[3-methyl-1-oxo-1-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]butan-2-yl]benzamide.
| Compound Name | 2-methyl-N-[3-methyl-1-oxo-1-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 43041619 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-methyl-N-[3-methyl-1-oxo-1-[(6-pyrrolidin-1-yl-3-pyridinyl)amino]butan-2-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)NC(C(=O)Nc1ccc(N2CCCC2)nc1)C(C)C |
| InChI | InChI=1S/C22H28N4O2/c1-15(2)20(25-21(27)18-9-5-4-8-16(18)3)22(28)24-17-10-11-19(23-14-17)26-12-6-7-13-26/h4-5,8-11,14-15,20H,6-7,12-13H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | SVDDYZTYQPYPMD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |