C22H19Br2F2N5O4 — CID 162100271
5-bromo-1,4-dimethylbenzotriazole;1-bromo-4-fluoro-2-methyl-3-nitrobenzene;1-fluoro-3-methyl-2-nitrobenzene (PubChem CID 162100271) has the molecular formula C22H19Br2F2N5O4 and a molecular weight of 615.23 g/mol. Its IUPAC name is 5-bromo-1,4-dimethylbenzotriazole;1-bromo-4-fluoro-2-methyl-3-nitrobenzene;1-fluoro-3-methyl-2-nitrobenzene.
| Compound Name | 5-bromo-1,4-dimethylbenzotriazole;1-bromo-4-fluoro-2-methyl-3-nitrobenzene;1-fluoro-3-methyl-2-nitrobenzene |
|---|---|
| PubChem CID | 162100271 |
| Molecular Formula | C22H19Br2F2N5O4 |
| Molecular Weight | 615.23 g/mol |
| Exact Mass | 612.98 |
| IUPAC Name | 5-bromo-1,4-dimethylbenzotriazole;1-bromo-4-fluoro-2-methyl-3-nitrobenzene;1-fluoro-3-methyl-2-nitrobenzene |
| SMILES | Cc1c(Br)ccc(F)c1[N+](=O)[O-].Cc1c(Br)ccc2c1nnn2C.Cc1cccc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H8BrN3.C7H5BrFNO2.C7H6FNO2/c1-5-6(9)3-4-7-8(5)10-11-12(7)2;1-4-5(8)2-3-6(9)7(4)10(11)12;1-5-3-2-4-6(8)7(5)9(10)11/h3-4H,1-2H3;2-3H,1H3;2-4H,1H3 |
| InChIKey | ZEUCJISSBPMRSH-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 116.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.23 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|