C25H25NO2 — CID 162102308
(2E)-5-hydroxy-2-(3H-inden-1-ylmethylidene)-4-(piperidin-1-ylmethyl)-3H-inden-1-one (PubChem CID 162102308) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is (2E)-5-hydroxy-2-(3H-inden-1-ylmethylidene)-4-(piperidin-1-ylmethyl)-3H-inden-1-one.
| Compound Name | (2E)-5-hydroxy-2-(3H-inden-1-ylmethylidene)-4-(piperidin-1-ylmethyl)-3H-inden-1-one |
|---|---|
| PubChem CID | 162102308 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (2E)-5-hydroxy-2-(3H-inden-1-ylmethylidene)-4-(piperidin-1-ylmethyl)-3H-inden-1-one |
| SMILES | O=C1/C(=C/C2=CCc3ccccc32)Cc2c1ccc(O)c2CN1CCCCC1 |
| InChI | InChI=1S/C25H25NO2/c27-24-11-10-21-22(23(24)16-26-12-4-1-5-13-26)15-19(25(21)28)14-18-9-8-17-6-2-3-7-20(17)18/h2-3,6-7,9-11,14,27H,1,4-5,8,12-13,15-16H2/b19-14+ |
| InChIKey | CIHGXLAZFDKDPN-XMHGGMMESA-N |
| XLogP | 4.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|