C24H24N2O3 — CID 161320110
(2Z)-7-(1,4-diazepan-1-ylmethyl)-6-hydroxy-2-(3H-inden-1-ylmethylidene)-1-benzofuran-3-one (PubChem CID 161320110) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is (2Z)-7-(1,4-diazepan-1-ylmethyl)-6-hydroxy-2-(3H-inden-1-ylmethylidene)-1-benzofuran-3-one.
| Compound Name | (2Z)-7-(1,4-diazepan-1-ylmethyl)-6-hydroxy-2-(3H-inden-1-ylmethylidene)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 161320110 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (2Z)-7-(1,4-diazepan-1-ylmethyl)-6-hydroxy-2-(3H-inden-1-ylmethylidene)-1-benzofuran-3-one |
| SMILES | O=C1/C(=C/C2=CCc3ccccc32)Oc2c1ccc(O)c2CN1CCCNCC1 |
| InChI | InChI=1S/C24H24N2O3/c27-21-9-8-19-23(28)22(14-17-7-6-16-4-1-2-5-18(16)17)29-24(19)20(21)15-26-12-3-10-25-11-13-26/h1-2,4-5,7-9,14,25,27H,3,6,10-13,15H2/b22-14- |
| InChIKey | ADRJRVCCBJIGRS-HMAPJEAMSA-N |
| XLogP | 3.29 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|