C28H24ClN3O5S — CID 123699450
2-[[1-(4-chlorophenyl)sulfonylindol-3-yl]methylidene]-6-hydroxy-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one (PubChem CID 123699450) has the molecular formula C28H24ClN3O5S and a molecular weight of 550.04 g/mol. Its IUPAC name is 2-[[1-(4-chlorophenyl)sulfonylindol-3-yl]methylidene]-6-hydroxy-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one.
| Compound Name | 2-[[1-(4-chlorophenyl)sulfonylindol-3-yl]methylidene]-6-hydroxy-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 123699450 |
| Molecular Formula | C28H24ClN3O5S |
| Molecular Weight | 550.04 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | 2-[[1-(4-chlorophenyl)sulfonylindol-3-yl]methylidene]-6-hydroxy-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one |
| SMILES | O=C1C(=Cc2cn(S(=O)(=O)c3ccc(Cl)cc3)c3ccccc23)Oc2c1ccc(O)c2CN1CCNCC1 |
| InChI | InChI=1S/C28H24ClN3O5S/c29-19-5-7-20(8-6-19)38(35,36)32-16-18(21-3-1-2-4-24(21)32)15-26-27(34)22-9-10-25(33)23(28(22)37-26)17-31-13-11-30-12-14-31/h1-10,15-16,30,33H,11-14,17H2 |
| InChIKey | PVMVNPDKSUTLJU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.04 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|