C34H35N3O7S — CID 86681964
tert-butyl 4-[[(2Z)-6-hydroxy-2-[[1-(4-methylphenyl)sulfonylindol-3-yl]methylidene]-3-oxo-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate (PubChem CID 86681964) has the molecular formula C34H35N3O7S and a molecular weight of 629.74 g/mol. Its IUPAC name is tert-butyl 4-[[(2Z)-6-hydroxy-2-[[1-(4-methylphenyl)sulfonylindol-3-yl]methylidene]-3-oxo-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(2Z)-6-hydroxy-2-[[1-(4-methylphenyl)sulfonylindol-3-yl]methylidene]-3-oxo-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86681964 |
| Molecular Formula | C34H35N3O7S |
| Molecular Weight | 629.74 g/mol |
| Exact Mass | 629.22 |
| IUPAC Name | tert-butyl 4-[[(2Z)-6-hydroxy-2-[[1-(4-methylphenyl)sulfonylindol-3-yl]methylidene]-3-oxo-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(/C=C3\Oc4c(ccc(O)c4CN4CCN(C(=O)OC(C)(C)C)CC4)C3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C34H35N3O7S/c1-22-9-11-24(12-10-22)45(41,42)37-20-23(25-7-5-6-8-28(25)37)19-30-31(39)26-13-14-29(38)27(32(26)43-30)21-35-15-17-36(18-16-35)33(40)44-34(2,3)4/h5-14,19-20,38H,15-18,21H2,1-4H3/b30-19- |
| InChIKey | PCJBCIQTCLXEGB-FSGOGVSDSA-N |
| XLogP | 5.56 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.74 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|