C28H31N3O5 — CID 123364934
tert-butyl 4-[[6-hydroxy-2-[(2-methyl-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate (PubChem CID 123364934) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is tert-butyl 4-[[6-hydroxy-2-[(2-methyl-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-hydroxy-2-[(2-methyl-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 123364934 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | tert-butyl 4-[[6-hydroxy-2-[(2-methyl-1H-indol-3-yl)methylidene]-3-oxo-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate |
| SMILES | Cc1[nH]c2ccccc2c1C=C1Oc2c(ccc(O)c2CN2CCN(C(=O)OC(C)(C)C)CC2)C1=O |
| InChI | InChI=1S/C28H31N3O5/c1-17-20(18-7-5-6-8-22(18)29-17)15-24-25(33)19-9-10-23(32)21(26(19)35-24)16-30-11-13-31(14-12-30)27(34)36-28(2,3)4/h5-10,15,29,32H,11-14,16H2,1-4H3 |
| InChIKey | BUBZGLOKHUIJID-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|