C27H28BrN3O5 — CID 86681939
tert-butyl 4-[[(2Z)-2-[(5-bromo-1H-indol-3-yl)methylidene]-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate (PubChem CID 86681939) has the molecular formula C27H28BrN3O5 and a molecular weight of 554.44 g/mol. Its IUPAC name is tert-butyl 4-[[(2Z)-2-[(5-bromo-1H-indol-3-yl)methylidene]-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(2Z)-2-[(5-bromo-1H-indol-3-yl)methylidene]-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86681939 |
| Molecular Formula | C27H28BrN3O5 |
| Molecular Weight | 554.44 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | tert-butyl 4-[[(2Z)-2-[(5-bromo-1H-indol-3-yl)methylidene]-6-hydroxy-3-oxo-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2c(O)ccc3c2O/C(=C\c2c[nH]c4ccc(Br)cc24)C3=O)CC1 |
| InChI | InChI=1S/C27H28BrN3O5/c1-27(2,3)36-26(34)31-10-8-30(9-11-31)15-20-22(32)7-5-18-24(33)23(35-25(18)20)12-16-14-29-21-6-4-17(28)13-19(16)21/h4-7,12-14,29,32H,8-11,15H2,1-3H3/b23-12- |
| InChIKey | BMQIEOKUIRZBSZ-FMCGGJTJSA-N |
| XLogP | 5.30 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|