C26H28N4O5 — CID 123838953
tert-butyl 4-[[6-hydroxy-3-oxo-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate (PubChem CID 123838953) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is tert-butyl 4-[[6-hydroxy-3-oxo-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-hydroxy-3-oxo-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 123838953 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | tert-butyl 4-[[6-hydroxy-3-oxo-2-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)-1-benzofuran-7-yl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2c(O)ccc3c2OC(=Cc2c[nH]c4ncccc24)C3=O)CC1 |
| InChI | InChI=1S/C26H28N4O5/c1-26(2,3)35-25(33)30-11-9-29(10-12-30)15-19-20(31)7-6-18-22(32)21(34-23(18)19)13-16-14-28-24-17(16)5-4-8-27-24/h4-8,13-14,31H,9-12,15H2,1-3H3,(H,27,28) |
| InChIKey | FBDBUURXYBNZNB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 107.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|