C22H22Cl2N4O5 — CID 86681927
(2Z)-6-hydroxy-2-[(5-nitro-1H-indol-3-yl)methylidene]-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one;dihydrochloride (PubChem CID 86681927) has the molecular formula C22H22Cl2N4O5 and a molecular weight of 493.35 g/mol. Its IUPAC name is (2Z)-6-hydroxy-2-[(5-nitro-1H-indol-3-yl)methylidene]-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one;dihydrochloride.
| Compound Name | (2Z)-6-hydroxy-2-[(5-nitro-1H-indol-3-yl)methylidene]-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one;dihydrochloride |
|---|---|
| PubChem CID | 86681927 |
| Molecular Formula | C22H22Cl2N4O5 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | (2Z)-6-hydroxy-2-[(5-nitro-1H-indol-3-yl)methylidene]-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1/C(=C/c2c[nH]c3ccc([N+](=O)[O-])cc23)Oc2c1ccc(O)c2CN1CCNCC1 |
| InChI | InChI=1S/C22H20N4O5.2ClH/c27-19-4-2-15-21(28)20(31-22(15)17(19)12-25-7-5-23-6-8-25)9-13-11-24-18-3-1-14(26(29)30)10-16(13)18;;/h1-4,9-11,23-24,27H,5-8,12H2;2*1H/b20-9-;; |
| InChIKey | NRUWAHCKYMRVQE-DPCMBIKASA-N |
| XLogP | 3.65 |
| TPSA | 120.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|