C23H23N3O3 — CID 160668750
(2Z)-2-[(5-amino-3H-inden-1-yl)methylidene]-6-hydroxy-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one (PubChem CID 160668750) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is (2Z)-2-[(5-amino-3H-inden-1-yl)methylidene]-6-hydroxy-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one.
| Compound Name | (2Z)-2-[(5-amino-3H-inden-1-yl)methylidene]-6-hydroxy-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 160668750 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (2Z)-2-[(5-amino-3H-inden-1-yl)methylidene]-6-hydroxy-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one |
| SMILES | Nc1ccc2c(c1)CC=C2/C=C1\Oc2c(ccc(O)c2CN2CCNCC2)C1=O |
| InChI | InChI=1S/C23H23N3O3/c24-16-3-4-17-14(11-16)1-2-15(17)12-21-22(28)18-5-6-20(27)19(23(18)29-21)13-26-9-7-25-8-10-26/h2-6,11-12,25,27H,1,7-10,13,24H2/b21-12- |
| InChIKey | XCMONRZJBWZISG-MTJSOVHGSA-N |
| XLogP | 2.48 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|