C28H23Cl2N3O5S — CID 123829725
2-[[1-(2,6-dichlorophenyl)sulfonylindol-3-yl]methylidene]-6-hydroxy-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one (PubChem CID 123829725) has the molecular formula C28H23Cl2N3O5S and a molecular weight of 584.48 g/mol. Its IUPAC name is 2-[[1-(2,6-dichlorophenyl)sulfonylindol-3-yl]methylidene]-6-hydroxy-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one.
| Compound Name | 2-[[1-(2,6-dichlorophenyl)sulfonylindol-3-yl]methylidene]-6-hydroxy-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 123829725 |
| Molecular Formula | C28H23Cl2N3O5S |
| Molecular Weight | 584.48 g/mol |
| Exact Mass | 583.07 |
| IUPAC Name | 2-[[1-(2,6-dichlorophenyl)sulfonylindol-3-yl]methylidene]-6-hydroxy-7-(piperazin-1-ylmethyl)-1-benzofuran-3-one |
| SMILES | O=C1C(=Cc2cn(S(=O)(=O)c3c(Cl)cccc3Cl)c3ccccc23)Oc2c1ccc(O)c2CN1CCNCC1 |
| InChI | InChI=1S/C28H23Cl2N3O5S/c29-21-5-3-6-22(30)28(21)39(36,37)33-15-17(18-4-1-2-7-23(18)33)14-25-26(35)19-8-9-24(34)20(27(19)38-25)16-32-12-10-31-11-13-32/h1-9,14-15,31,34H,10-13,16H2 |
| InChIKey | QRSNEVQVHOABTG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|