C20H19BClN3O6 — CID 162108740
2-amino-4-(3-chloro-2-pyridinyl)benzoic acid;(3-amino-4-methoxycarbonylphenyl)boronic acid (PubChem CID 162108740) has the molecular formula C20H19BClN3O6 and a molecular weight of 443.65 g/mol. Its IUPAC name is 2-amino-4-(3-chloro-2-pyridinyl)benzoic acid;(3-amino-4-methoxycarbonylphenyl)boronic acid.
| Compound Name | 2-amino-4-(3-chloro-2-pyridinyl)benzoic acid;(3-amino-4-methoxycarbonylphenyl)boronic acid |
|---|---|
| PubChem CID | 162108740 |
| Molecular Formula | C20H19BClN3O6 |
| Molecular Weight | 443.65 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 2-amino-4-(3-chloro-2-pyridinyl)benzoic acid;(3-amino-4-methoxycarbonylphenyl)boronic acid |
| SMILES | COC(=O)c1ccc(B(O)O)cc1N.Nc1cc(-c2ncccc2Cl)ccc1C(=O)O |
| InChI | InChI=1S/C12H9ClN2O2.C8H10BNO4/c13-9-2-1-5-15-11(9)7-3-4-8(12(16)17)10(14)6-7;1-14-8(11)6-3-2-5(9(12)13)4-7(6)10/h1-6H,14H2,(H,16,17);2-4,12-13H,10H2,1H3 |
| InChIKey | ZFWCVEJEDCYGGI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 168.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.65 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|