C41H38N8O4 — CID 162113175
1-benzyl-3-phenyl-1,3-diazinane-2,4,6-trione;6-N-(4-methoxyphenyl)-2-N,4-N-bis(3-methylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 162113175) has the molecular formula C41H38N8O4 and a molecular weight of 706.81 g/mol. Its IUPAC name is 1-benzyl-3-phenyl-1,3-diazinane-2,4,6-trione;6-N-(4-methoxyphenyl)-2-N,4-N-bis(3-methylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 1-benzyl-3-phenyl-1,3-diazinane-2,4,6-trione;6-N-(4-methoxyphenyl)-2-N,4-N-bis(3-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 162113175 |
| Molecular Formula | C41H38N8O4 |
| Molecular Weight | 706.81 g/mol |
| Exact Mass | 706.30 |
| IUPAC Name | 1-benzyl-3-phenyl-1,3-diazinane-2,4,6-trione;6-N-(4-methoxyphenyl)-2-N,4-N-bis(3-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(Nc2nc(Nc3cccc(C)c3)nc(Nc3cccc(C)c3)n2)cc1.O=C1CC(=O)N(c2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H24N6O.C17H14N2O3/c1-16-6-4-8-19(14-16)26-23-28-22(25-18-10-12-21(31-3)13-11-18)29-24(30-23)27-20-9-5-7-17(2)15-20;20-15-11-16(21)19(14-9-5-2-6-10-14)17(22)18(15)12-13-7-3-1-4-8-13/h4-15H,1-3H3,(H3,25,26,27,28,29,30);1-10H,11-12H2 |
| InChIKey | ZGKNZAOOKRZAER-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.81 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|