C26H40N8O8 — CID 162113277
2-(4-amino-5-methoxy-N-methyl-2-nitroanilino)-N,N-dimethylpropanamide (PubChem CID 162113277) has the molecular formula C26H40N8O8 and a molecular weight of 592.65 g/mol. Its IUPAC name is 2-(4-amino-5-methoxy-N-methyl-2-nitroanilino)-N,N-dimethylpropanamide.
| Compound Name | 2-(4-amino-5-methoxy-N-methyl-2-nitroanilino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 162113277 |
| Molecular Formula | C26H40N8O8 |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | 2-(4-amino-5-methoxy-N-methyl-2-nitroanilino)-N,N-dimethylpropanamide |
| SMILES | COc1cc(N(C)C(C)C(=O)N(C)C)c([N+](=O)[O-])cc1N.COc1cc(N(C)C(C)C(=O)N(C)C)c([N+](=O)[O-])cc1N |
| InChI | InChI=1S/2C13H20N4O4/c2*1-8(13(18)15(2)3)16(4)10-7-12(21-5)9(14)6-11(10)17(19)20/h2*6-8H,14H2,1-5H3 |
| InChIKey | ZGKXYQIVAGCZHU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 203.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|