C30H42N4O3 — CID 162114928
N-(2-aminophenyl)-2-methylpropanamide;[6-(diethylaminomethyl)naphthalen-2-yl]methyl N-propan-2-ylcarbamate (PubChem CID 162114928) has the molecular formula C30H42N4O3 and a molecular weight of 506.69 g/mol. Its IUPAC name is N-(2-aminophenyl)-2-methylpropanamide;[6-(diethylaminomethyl)naphthalen-2-yl]methyl N-propan-2-ylcarbamate.
| Compound Name | N-(2-aminophenyl)-2-methylpropanamide;[6-(diethylaminomethyl)naphthalen-2-yl]methyl N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 162114928 |
| Molecular Formula | C30H42N4O3 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.33 |
| IUPAC Name | N-(2-aminophenyl)-2-methylpropanamide;[6-(diethylaminomethyl)naphthalen-2-yl]methyl N-propan-2-ylcarbamate |
| SMILES | CC(C)C(=O)Nc1ccccc1N.CCN(CC)Cc1ccc2cc(COC(=O)NC(C)C)ccc2c1 |
| InChI | InChI=1S/C20H28N2O2.C10H14N2O/c1-5-22(6-2)13-16-7-9-19-12-17(8-10-18(19)11-16)14-24-20(23)21-15(3)4;1-7(2)10(13)12-9-6-4-3-5-8(9)11/h7-12,15H,5-6,13-14H2,1-4H3,(H,21,23);3-7H,11H2,1-2H3,(H,12,13) |
| InChIKey | ZGQGNOOUAUSULV-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|