C18H23N3O4 — CID 177058241
2-(2-aminoanilino)-2-(phenylmethoxycarbonylamino)acetic acid;ethane (PubChem CID 177058241) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-(2-aminoanilino)-2-(phenylmethoxycarbonylamino)acetic acid;ethane.
| Compound Name | 2-(2-aminoanilino)-2-(phenylmethoxycarbonylamino)acetic acid;ethane |
|---|---|
| PubChem CID | 177058241 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-(2-aminoanilino)-2-(phenylmethoxycarbonylamino)acetic acid;ethane |
| SMILES | CC.Nc1ccccc1NC(NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H17N3O4.C2H6/c17-12-8-4-5-9-13(12)18-14(15(20)21)19-16(22)23-10-11-6-2-1-3-7-11;1-2/h1-9,14,18H,10,17H2,(H,19,22)(H,20,21);1-2H3 |
| InChIKey | LFYRAECNRQIPQW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|