C15H28N2O4S — CID 162128765
butyl 3,4-diamino-2-cyclohexyl-3-methylsulfinyl-4-oxobutanoate (PubChem CID 162128765) has the molecular formula C15H28N2O4S and a molecular weight of 332.47 g/mol. Its IUPAC name is butyl 3,4-diamino-2-cyclohexyl-3-methylsulfinyl-4-oxobutanoate.
| Compound Name | butyl 3,4-diamino-2-cyclohexyl-3-methylsulfinyl-4-oxobutanoate |
|---|---|
| PubChem CID | 162128765 |
| Molecular Formula | C15H28N2O4S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | butyl 3,4-diamino-2-cyclohexyl-3-methylsulfinyl-4-oxobutanoate |
| SMILES | CCCCOC(=O)C(C1CCCCC1)C(N)(C(N)=O)S(C)=O |
| InChI | InChI=1S/C15H28N2O4S/c1-3-4-10-21-13(18)12(11-8-6-5-7-9-11)15(17,14(16)19)22(2)20/h11-12H,3-10,17H2,1-2H3,(H2,16,19) |
| InChIKey | ZIJTZNAHSYFFID-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|