C40H48F5O6PS — CID 162131952
dibenzyl [(7R,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-7-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] phosphate (PubChem CID 162131952) has the molecular formula C40H48F5O6PS and a molecular weight of 782.85 g/mol. Its IUPAC name is dibenzyl [(7R,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-7-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] phosphate.
| Compound Name | dibenzyl [(7R,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-7-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] phosphate |
|---|---|
| PubChem CID | 162131952 |
| Molecular Formula | C40H48F5O6PS |
| Molecular Weight | 782.85 g/mol |
| Exact Mass | 782.28 |
| IUPAC Name | dibenzyl [(7R,8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-7-[3-(4,4,5,5,5-pentafluoropentylsulfinyl)propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] phosphate |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OP(=O)(OCc5ccccc5)OCc5ccccc5)cc4C[C@@H](CCCS(=O)CCCC(F)(F)C(F)(F)F)[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C40H48F5O6PS/c1-38-21-19-34-33-16-15-32(51-52(47,49-26-28-10-4-2-5-11-28)50-27-29-12-6-3-7-13-29)25-31(33)24-30(37(34)35(38)17-18-36(38)46)14-8-22-53(48)23-9-20-39(41,42)40(43,44)45/h2-7,10-13,15-16,25,30,34-37,46H,8-9,14,17-24,26-27H2,1H3/t30-,34-,35+,36+,37-,38+,53?/m1/s1 |
| InChIKey | QTOQBQMOHJLKSF-FVUDTQLWSA-N |
| XLogP | 10.56 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.85 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|