C33H33BrN4 — CID 162136464
1-(bromomethyl)-4-(2-methylphenyl)benzene;4-methyl-6-(1-methylbenzimidazol-2-yl)-2-propyl-1H-benzimidazole (PubChem CID 162136464) has the molecular formula C33H33BrN4 and a molecular weight of 565.56 g/mol. Its IUPAC name is 1-(bromomethyl)-4-(2-methylphenyl)benzene;4-methyl-6-(1-methylbenzimidazol-2-yl)-2-propyl-1H-benzimidazole.
| Compound Name | 1-(bromomethyl)-4-(2-methylphenyl)benzene;4-methyl-6-(1-methylbenzimidazol-2-yl)-2-propyl-1H-benzimidazole |
|---|---|
| PubChem CID | 162136464 |
| Molecular Formula | C33H33BrN4 |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 1-(bromomethyl)-4-(2-methylphenyl)benzene;4-methyl-6-(1-methylbenzimidazol-2-yl)-2-propyl-1H-benzimidazole |
| SMILES | CCCc1nc2c(C)cc(-c3nc4ccccc4n3C)cc2[nH]1.Cc1ccccc1-c1ccc(CBr)cc1 |
| InChI | InChI=1S/C19H20N4.C14H13Br/c1-4-7-17-20-15-11-13(10-12(2)18(15)22-17)19-21-14-8-5-6-9-16(14)23(19)3;1-11-4-2-3-5-14(11)13-8-6-12(10-15)7-9-13/h5-6,8-11H,4,7H2,1-3H3,(H,20,22);2-9H,10H2,1H3 |
| InChIKey | ZJIWDTBHKKECCK-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|