C33H31N4O2+ — CID 87499702
2-[4-[[1-methyl-2-(7-methyl-2-propyl-3H-benzimidazol-5-yl)benzimidazol-1-ium-1-yl]methyl]phenyl]benzoic acid (PubChem CID 87499702) has the molecular formula C33H31N4O2+ and a molecular weight of 515.64 g/mol. Its IUPAC name is 2-[4-[[1-methyl-2-(7-methyl-2-propyl-3H-benzimidazol-5-yl)benzimidazol-1-ium-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[1-methyl-2-(7-methyl-2-propyl-3H-benzimidazol-5-yl)benzimidazol-1-ium-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 87499702 |
| Molecular Formula | C33H31N4O2+ |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | 2-[4-[[1-methyl-2-(7-methyl-2-propyl-3H-benzimidazol-5-yl)benzimidazol-1-ium-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCc1nc2c(C)cc(C3=Nc4ccccc4[N+]3(C)Cc3ccc(-c4ccccc4C(=O)O)cc3)cc2[nH]1 |
| InChI | InChI=1S/C33H30N4O2/c1-4-9-30-34-28-19-24(18-21(2)31(28)36-30)32-35-27-12-7-8-13-29(27)37(32,3)20-22-14-16-23(17-15-22)25-10-5-6-11-26(25)33(38)39/h5-8,10-19H,4,9,20H2,1-3H3,(H-,34,35,36,38,39)/p+1 |
| InChIKey | ZZLDUTMGJAUKDU-UHFFFAOYSA-O |
| XLogP | 7.42 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|