About N-benzyl-2-isocyanoacetamide;2-isocyanoacetic acid
N-benzyl-2-isocyanoacetamide;2-isocyanoacetic acid (PubChem CID 162136507) has the molecular formula C13H13N3O3
and a molecular weight of 259.26 g/mol. Its IUPAC name is N-benzyl-2-isocyanoacetamide;2-isocyanoacetic acid.
Molecular Properties
| Compound Name | N-benzyl-2-isocyanoacetamide;2-isocyanoacetic acid |
| PubChem CID | 162136507 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-benzyl-2-isocyanoacetamide;2-isocyanoacetic acid |
| SMILES | [C-]#[N+]CC(=O)NCc1ccccc1.[C-]#[N+]CC(=O)O |
| InChI | InChI=1S/C10H10N2O.C3H3NO2/c1-11-8-10(13)12-7-9-5-3-2-4-6-9;1-4-2-3(5)6/h2-6H,7-8H2,(H,12,13);2H2,(H,5,6) |
| InChIKey | ZJIYTUKEFFDPAG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 75.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-isocyanoacetamide;2-isocyanoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-isocyanoacetamide;2-isocyanoacetic acid?
The IUPAC name of N-benzyl-2-isocyanoacetamide;2-isocyanoacetic acid (CID 162136507) is N-benzyl-2-isocyanoacetamide;2-isocyanoacetic acid.
What is the SMILES notation for N-benzyl-2-isocyanoacetamide;2-isocyanoacetic acid?
The canonical SMILES for N-benzyl-2-isocyanoacetamide;2-isocyanoacetic acid is [C-]#[N+]CC(=O)NCc1ccccc1.[C-]#[N+]CC(=O)O.
What is the InChIKey of N-benzyl-2-isocyanoacetamide;2-isocyanoacetic acid?
The InChIKey is ZJIYTUKEFFDPAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O.C3H3NO2/c1-11-8-10(13)12-7-9-5-3-2-4-6-9;1-4-2-3(5)6/h2-6H,7-8H2,(H,12,13);2H2,(H,5,6).
What are the key properties of N-benzyl-2-isocyanoacetamide;2-isocyanoacetic acid?
N-benzyl-2-isocyanoacetamide;2-isocyanoacetic acid has a molecular weight of 259.26 g/mol, XLogP of 1.21, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-isocyanoacetamide;2-isocyanoacetic acid is sourced from PubChem (CID 162136507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).