C23H28N2O3 — CID 162147233
2-(oxiran-2-ylmethylamino)acetic acid;N-(1-phenylpropyl)-1H-inden-1-amine (PubChem CID 162147233) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethylamino)acetic acid;N-(1-phenylpropyl)-1H-inden-1-amine.
| Compound Name | 2-(oxiran-2-ylmethylamino)acetic acid;N-(1-phenylpropyl)-1H-inden-1-amine |
|---|---|
| PubChem CID | 162147233 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 2-(oxiran-2-ylmethylamino)acetic acid;N-(1-phenylpropyl)-1H-inden-1-amine |
| SMILES | CCC(NC1C=Cc2ccccc21)c1ccccc1.O=C(O)CNCC1CO1 |
| InChI | InChI=1S/C18H19N.C5H9NO3/c1-2-17(15-9-4-3-5-10-15)19-18-13-12-14-8-6-7-11-16(14)18;7-5(8)2-6-1-4-3-9-4/h3-13,17-19H,2H2,1H3;4,6H,1-3H2,(H,7,8) |
| InChIKey | ZKSJUUQIIZNATR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|