C33H66 — CID 162149662
bis(1-tert-butyl-1-(2,2-dimethylpropyl)cyclopropane);1-(2,2-dimethylpropyl)-1-methylcyclopropane (PubChem CID 162149662) has the molecular formula C33H66 and a molecular weight of 462.89 g/mol. Its IUPAC name is bis(1-tert-butyl-1-(2,2-dimethylpropyl)cyclopropane);1-(2,2-dimethylpropyl)-1-methylcyclopropane.
| Compound Name | bis(1-tert-butyl-1-(2,2-dimethylpropyl)cyclopropane);1-(2,2-dimethylpropyl)-1-methylcyclopropane |
|---|---|
| PubChem CID | 162149662 |
| Molecular Formula | C33H66 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.52 |
| IUPAC Name | bis(1-tert-butyl-1-(2,2-dimethylpropyl)cyclopropane);1-(2,2-dimethylpropyl)-1-methylcyclopropane |
| SMILES | CC(C)(C)CC1(C(C)(C)C)CC1.CC(C)(C)CC1(C(C)(C)C)CC1.CC(C)(C)CC1(C)CC1 |
| InChI | InChI=1S/2C12H24.C9H18/c2*1-10(2,3)9-12(7-8-12)11(4,5)6;1-8(2,3)7-9(4)5-6-9/h2*7-9H2,1-6H3;5-7H2,1-4H3 |
| InChIKey | ZLAIIABGLYTIMN-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |