C26H42N6 — CID 162149780
bis(5-propan-2-yl-1H-imidazole);2-propan-2-yl-1H-pyrrole;4-propan-2-yl-3H-pyrrole (PubChem CID 162149780) has the molecular formula C26H42N6 and a molecular weight of 438.66 g/mol. Its IUPAC name is bis(5-propan-2-yl-1H-imidazole);2-propan-2-yl-1H-pyrrole;4-propan-2-yl-3H-pyrrole.
| Compound Name | bis(5-propan-2-yl-1H-imidazole);2-propan-2-yl-1H-pyrrole;4-propan-2-yl-3H-pyrrole |
|---|---|
| PubChem CID | 162149780 |
| Molecular Formula | C26H42N6 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | bis(5-propan-2-yl-1H-imidazole);2-propan-2-yl-1H-pyrrole;4-propan-2-yl-3H-pyrrole |
| SMILES | CC(C)C1=CN=CC1.CC(C)c1ccc[nH]1.CC(C)c1cnc[nH]1.CC(C)c1cnc[nH]1 |
| InChI | InChI=1S/2C7H11N.2C6H10N2/c1-6(2)7-3-4-8-5-7;1-6(2)7-4-3-5-8-7;2*1-5(2)6-3-7-4-8-6/h4-6H,3H2,1-2H3;3-6,8H,1-2H3;2*3-5H,1-2H3,(H,7,8) |
| InChIKey | ZLAVGYSVWZNHCM-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |