C32H18N4O2 — CID 162152400
4-[4-(4-isocyano-3-pyridinyl)carbazol-9-yl]-2-phenylisoindole-1,3-dione (PubChem CID 162152400) has the molecular formula C32H18N4O2 and a molecular weight of 490.52 g/mol. Its IUPAC name is 4-[4-(4-isocyano-3-pyridinyl)carbazol-9-yl]-2-phenylisoindole-1,3-dione.
| Compound Name | 4-[4-(4-isocyano-3-pyridinyl)carbazol-9-yl]-2-phenylisoindole-1,3-dione |
|---|---|
| PubChem CID | 162152400 |
| Molecular Formula | C32H18N4O2 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 4-[4-(4-isocyano-3-pyridinyl)carbazol-9-yl]-2-phenylisoindole-1,3-dione |
| SMILES | [C-]#[N+]c1ccncc1-c1cccc2c1c1ccccc1n2-c1cccc2c1C(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C32H18N4O2/c1-33-25-17-18-34-19-24(25)21-12-7-15-27-29(21)22-11-5-6-14-26(22)36(27)28-16-8-13-23-30(28)32(38)35(31(23)37)20-9-3-2-4-10-20/h2-19H |
| InChIKey | YNAXDAZWTLFSKW-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 59.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|