C18H27NO4S — CID 162160697
3-methylbutan-2-one;2-(2-methylpropanoylamino)-3-phenyl-3-sulfanylpropanoic acid (PubChem CID 162160697) has the molecular formula C18H27NO4S and a molecular weight of 353.48 g/mol. Its IUPAC name is 3-methylbutan-2-one;2-(2-methylpropanoylamino)-3-phenyl-3-sulfanylpropanoic acid.
| Compound Name | 3-methylbutan-2-one;2-(2-methylpropanoylamino)-3-phenyl-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 162160697 |
| Molecular Formula | C18H27NO4S |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-methylbutan-2-one;2-(2-methylpropanoylamino)-3-phenyl-3-sulfanylpropanoic acid |
| SMILES | CC(=O)C(C)C.CC(C)C(=O)NC(C(=O)O)C(S)c1ccccc1 |
| InChI | InChI=1S/C13H17NO3S.C5H10O/c1-8(2)12(15)14-10(13(16)17)11(18)9-6-4-3-5-7-9;1-4(2)5(3)6/h3-8,10-11,18H,1-2H3,(H,14,15)(H,16,17);4H,1-3H3 |
| InChIKey | ZMKZFTMXERLPGV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|