C39H45N7O2 — CID 162162059
3-[2-[4-(dipropylamino)phenyl]-1-[2-[4-(hydroxymethyl)phenyl]ethyl]benzimidazol-5-yl]-3-(1H-indazol-5-ylmethylamino)propanamide (PubChem CID 162162059) has the molecular formula C39H45N7O2 and a molecular weight of 643.84 g/mol. Its IUPAC name is 3-[2-[4-(dipropylamino)phenyl]-1-[2-[4-(hydroxymethyl)phenyl]ethyl]benzimidazol-5-yl]-3-(1H-indazol-5-ylmethylamino)propanamide.
| Compound Name | 3-[2-[4-(dipropylamino)phenyl]-1-[2-[4-(hydroxymethyl)phenyl]ethyl]benzimidazol-5-yl]-3-(1H-indazol-5-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 162162059 |
| Molecular Formula | C39H45N7O2 |
| Molecular Weight | 643.84 g/mol |
| Exact Mass | 643.36 |
| IUPAC Name | 3-[2-[4-(dipropylamino)phenyl]-1-[2-[4-(hydroxymethyl)phenyl]ethyl]benzimidazol-5-yl]-3-(1H-indazol-5-ylmethylamino)propanamide |
| SMILES | CCCN(CCC)c1ccc(-c2nc3cc(C(CC(N)=O)NCc4ccc5[nH]ncc5c4)ccc3n2CCc2ccc(CO)cc2)cc1 |
| InChI | InChI=1S/C39H45N7O2/c1-3-18-45(19-4-2)33-13-10-30(11-14-33)39-43-36-22-31(12-16-37(36)46(39)20-17-27-5-7-28(26-47)8-6-27)35(23-38(40)48)41-24-29-9-15-34-32(21-29)25-42-44-34/h5-16,21-22,25,35,41,47H,3-4,17-20,23-24,26H2,1-2H3,(H2,40,48)(H,42,44) |
| InChIKey | ZMPSXZAYNIUYML-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.84 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|