C25H23N7O2 — CID 162167084
(3E)-3-[[4-(cyclopropylamino)-2-[2-[2-(2H-pyrrol-4-yl)phenyl]ethyl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 162167084) has the molecular formula C25H23N7O2 and a molecular weight of 453.51 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[2-[2-(2H-pyrrol-4-yl)phenyl]ethyl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[2-[2-(2H-pyrrol-4-yl)phenyl]ethyl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 162167084 |
| Molecular Formula | C25H23N7O2 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[2-[2-(2H-pyrrol-4-yl)phenyl]ethyl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(CCc4ccccc4C4=CCN=C4)nc23)C(=O)N1 |
| InChI | InChI=1S/C25H23N7O2/c33-22-12-17(24(34)31-22)11-18-14-27-32-23(18)29-21(30-25(32)28-19-6-7-19)8-5-15-3-1-2-4-20(15)16-9-10-26-13-16/h1-4,9,11,13-14,19H,5-8,10,12H2,(H,28,29,30)(H,31,33,34)/b17-11+ |
| InChIKey | ZNGVAOQKXDZLJU-GZTJUZNOSA-N |
| XLogP | 2.38 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|