C27H26N8O2 — CID 58314637
(3E)-3-[[2-[[2-[3-(aminomethyl)phenyl]phenyl]methylamino]-4-(cyclopropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314637) has the molecular formula C27H26N8O2 and a molecular weight of 494.56 g/mol. Its IUPAC name is (3E)-3-[[2-[[2-[3-(aminomethyl)phenyl]phenyl]methylamino]-4-(cyclopropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[2-[[2-[3-(aminomethyl)phenyl]phenyl]methylamino]-4-(cyclopropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314637 |
| Molecular Formula | C27H26N8O2 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | (3E)-3-[[2-[[2-[3-(aminomethyl)phenyl]phenyl]methylamino]-4-(cyclopropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | NCc1cccc(-c2ccccc2CNc2nc(NC3CC3)n3ncc(/C=C4\CC(=O)NC4=O)c3n2)c1 |
| InChI | InChI=1S/C27H26N8O2/c28-13-16-4-3-6-17(10-16)22-7-2-1-5-18(22)14-29-26-33-24-20(11-19-12-23(36)32-25(19)37)15-30-35(24)27(34-26)31-21-8-9-21/h1-7,10-11,15,21H,8-9,12-14,28H2,(H,32,36,37)(H2,29,31,33,34)/b19-11+ |
| InChIKey | MTNUYECTUPFHOF-YBFXNURJSA-N |
| XLogP | 2.87 |
| TPSA | 139.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|